C20H32O3Si — CID 11405341
(3aR,4R,5R)-5-hydroxy-5,7-dimethyl-4-triethylsilyloxyspiro[3a,4-dihydroindene-6,1'-cyclobutane]-1-one (PubChem CID 11405341) has the molecular formula C20H32O3Si and a molecular weight of 348.56 g/mol. Its IUPAC name is (3aR,4R,5R)-5-hydroxy-5,7-dimethyl-4-triethylsilyloxyspiro[3a,4-dihydroindene-6,1'-cyclobutane]-1-one.
| Compound Name | (3aR,4R,5R)-5-hydroxy-5,7-dimethyl-4-triethylsilyloxyspiro[3a,4-dihydroindene-6,1'-cyclobutane]-1-one |
|---|---|
| PubChem CID | 11405341 |
| Molecular Formula | C20H32O3Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (3aR,4R,5R)-5-hydroxy-5,7-dimethyl-4-triethylsilyloxyspiro[3a,4-dihydroindene-6,1'-cyclobutane]-1-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H]2C=CC(=O)C2=C(C)C2(CCC2)[C@@]1(C)O |
| InChI | InChI=1S/C20H32O3Si/c1-6-24(7-2,8-3)23-18-15-10-11-16(21)17(15)14(4)20(12-9-13-20)19(18,5)22/h10-11,15,18,22H,6-9,12-13H2,1-5H3/t15-,18-,19+/m1/s1 |
| InChIKey | PQROJXNWSQFVGT-LZQZEXGQSA-N |
| XLogP | 4.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|