C11H10ClN3O2S — CID 114053499
N-(4-chloro-6-methoxypyrimidin-2-yl)-3-methylthiophene-2-carboxamide (PubChem CID 114053499) has the molecular formula C11H10ClN3O2S and a molecular weight of 283.74 g/mol. Its IUPAC name is N-(4-chloro-6-methoxypyrimidin-2-yl)-3-methylthiophene-2-carboxamide.
| Compound Name | N-(4-chloro-6-methoxypyrimidin-2-yl)-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 114053499 |
| Molecular Formula | C11H10ClN3O2S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | N-(4-chloro-6-methoxypyrimidin-2-yl)-3-methylthiophene-2-carboxamide |
| SMILES | COc1cc(Cl)nc(NC(=O)c2sccc2C)n1 |
| InChI | InChI=1S/C11H10ClN3O2S/c1-6-3-4-18-9(6)10(16)15-11-13-7(12)5-8(14-11)17-2/h3-5H,1-2H3,(H,13,14,15,16) |
| InChIKey | IUWPVCVEYAMQKO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |