C21H38O2Si — CID 11405421
(4R,4aS,6R,10aS)-2-[tert-butyl(dimethyl)silyl]oxy-4,4a,6-trimethyl-1,4,6,7,8,9,10,10a-octahydrobenzo[8]annulen-5-one (PubChem CID 11405421) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is (4R,4aS,6R,10aS)-2-[tert-butyl(dimethyl)silyl]oxy-4,4a,6-trimethyl-1,4,6,7,8,9,10,10a-octahydrobenzo[8]annulen-5-one.
| Compound Name | (4R,4aS,6R,10aS)-2-[tert-butyl(dimethyl)silyl]oxy-4,4a,6-trimethyl-1,4,6,7,8,9,10,10a-octahydrobenzo[8]annulen-5-one |
|---|---|
| PubChem CID | 11405421 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (4R,4aS,6R,10aS)-2-[tert-butyl(dimethyl)silyl]oxy-4,4a,6-trimethyl-1,4,6,7,8,9,10,10a-octahydrobenzo[8]annulen-5-one |
| SMILES | C[C@@H]1CCCC[C@H]2CC(O[Si](C)(C)C(C)(C)C)=C[C@@H](C)[C@@]2(C)C1=O |
| InChI | InChI=1S/C21H38O2Si/c1-15-11-9-10-12-17-14-18(23-24(7,8)20(3,4)5)13-16(2)21(17,6)19(15)22/h13,15-17H,9-12,14H2,1-8H3/t15-,16-,17+,21-/m1/s1 |
| InChIKey | BJYXQJMXSYZMRI-PZTGFMGMSA-N |
| XLogP | 6.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|