About cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile
cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile (PubChem CID 11405427) has the molecular formula C18H11BrN2O
and a molecular weight of 351.20 g/mol. Its IUPAC name is cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile.
Molecular Properties
| Compound Name | cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile |
| PubChem CID | 11405427 |
| Molecular Formula | C18H11BrN2O |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)[C@H](C(=O)c2ccccc2)[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H11BrN2O/c19-14-8-6-12(7-9-14)15-16(18(15,10-20)11-21)17(22)13-4-2-1-3-5-13/h1-9,15-16H/t15-,16-/m0/s1 |
| InChIKey | JBMKNICESCIWEV-HOTGVXAUSA-N |
| XLogP | 4.08 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_cyano_B(3)', 'substructure': 'N/A'} |
|---|
Analyze cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile?
The IUPAC name of cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile (CID 11405427) is cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile.
What is the SMILES notation for cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile?
The canonical SMILES for cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile is N#CC1(C#N)[C@H](C(=O)c2ccccc2)[C@@H]1c1ccc(Br)cc1.
What is the InChIKey of cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile?
The InChIKey is JBMKNICESCIWEV-HOTGVXAUSA-N. The full InChI is InChI=1S/C18H11BrN2O/c19-14-8-6-12(7-9-14)15-16(18(15,10-20)11-21)17(22)13-4-2-1-3-5-13/h1-9,15-16H/t15-,16-/m0/s1.
What are the key properties of cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile?
cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile has a molecular weight of 351.20 g/mol, XLogP of 4.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2R,3R)-2-benzoyl-3-(4-bromophenyl)cyclopropane-1,1-dicarbonitrile is sourced from PubChem (CID 11405427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).