C14H17ClN2O — CID 114054833
4-[2-(chloromethyl)-4-methylphenoxy]-1-propylpyrazole (PubChem CID 114054833) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 4-[2-(chloromethyl)-4-methylphenoxy]-1-propylpyrazole.
| Compound Name | 4-[2-(chloromethyl)-4-methylphenoxy]-1-propylpyrazole |
|---|---|
| PubChem CID | 114054833 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-[2-(chloromethyl)-4-methylphenoxy]-1-propylpyrazole |
| SMILES | CCCn1cc(Oc2ccc(C)cc2CCl)cn1 |
| InChI | InChI=1S/C14H17ClN2O/c1-3-6-17-10-13(9-16-17)18-14-5-4-11(2)7-12(14)8-15/h4-5,7,9-10H,3,6,8H2,1-2H3 |
| InChIKey | HFURPWRLHMTTMW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|