C15H22N2O — CID 114055606
1-[2-(2-ethylazepan-1-yl)-3-pyridinyl]ethanone (PubChem CID 114055606) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-[2-(2-ethylazepan-1-yl)-3-pyridinyl]ethanone.
| Compound Name | 1-[2-(2-ethylazepan-1-yl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 114055606 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 1-[2-(2-ethylazepan-1-yl)-3-pyridinyl]ethanone |
| SMILES | CCC1CCCCCN1c1ncccc1C(C)=O |
| InChI | InChI=1S/C15H22N2O/c1-3-13-8-5-4-6-11-17(13)15-14(12(2)18)9-7-10-16-15/h7,9-10,13H,3-6,8,11H2,1-2H3 |
| InChIKey | DHKKRTPWWLBGJP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |