C15H21IO2 — CID 11405712
(1S,6S,10R,12S,17R)-8-iodo-11,13-dioxatetracyclo[8.7.0.01,6.012,17]heptadec-7-ene (PubChem CID 11405712) has the molecular formula C15H21IO2 and a molecular weight of 360.24 g/mol. Its IUPAC name is (1S,6S,10R,12S,17R)-8-iodo-11,13-dioxatetracyclo[8.7.0.01,6.012,17]heptadec-7-ene.
| Compound Name | (1S,6S,10R,12S,17R)-8-iodo-11,13-dioxatetracyclo[8.7.0.01,6.012,17]heptadec-7-ene |
|---|---|
| PubChem CID | 11405712 |
| Molecular Formula | C15H21IO2 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | (1S,6S,10R,12S,17R)-8-iodo-11,13-dioxatetracyclo[8.7.0.01,6.012,17]heptadec-7-ene |
| SMILES | IC1=C[C@@H]2CCCC[C@]23[C@@H](C1)O[C@@H]1OCCC[C@@H]13 |
| InChI | InChI=1S/C15H21IO2/c16-11-8-10-4-1-2-6-15(10)12-5-3-7-17-14(12)18-13(15)9-11/h8,10,12-14H,1-7,9H2/t10-,12-,13+,14-,15-/m0/s1 |
| InChIKey | CMLNMQITRRVZGI-DJIJKHNZSA-N |
| XLogP | 4.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|