C13H20N2OS — CID 114057301
3-[[3-[(cyclopropylamino)methyl]-2-pyridinyl]sulfanyl]-2-methylpropan-1-ol (PubChem CID 114057301) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is 3-[[3-[(cyclopropylamino)methyl]-2-pyridinyl]sulfanyl]-2-methylpropan-1-ol.
| Compound Name | 3-[[3-[(cyclopropylamino)methyl]-2-pyridinyl]sulfanyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 114057301 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 3-[[3-[(cyclopropylamino)methyl]-2-pyridinyl]sulfanyl]-2-methylpropan-1-ol |
| SMILES | CC(CO)CSc1ncccc1CNC1CC1 |
| InChI | InChI=1S/C13H20N2OS/c1-10(8-16)9-17-13-11(3-2-6-14-13)7-15-12-4-5-12/h2-3,6,10,12,15-16H,4-5,7-9H2,1H3 |
| InChIKey | ZOZFVEXTZVDZAD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |