C12H9F3N2S — CID 114058102
2-cyclopropyl-4-(2,4,5-trifluorophenyl)-1,3-thiazol-5-amine (PubChem CID 114058102) has the molecular formula C12H9F3N2S and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,4,5-trifluorophenyl)-1,3-thiazol-5-amine.
| Compound Name | 2-cyclopropyl-4-(2,4,5-trifluorophenyl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 114058102 |
| Molecular Formula | C12H9F3N2S |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2-cyclopropyl-4-(2,4,5-trifluorophenyl)-1,3-thiazol-5-amine |
| SMILES | Nc1sc(C2CC2)nc1-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H9F3N2S/c13-7-4-9(15)8(14)3-6(7)10-11(16)18-12(17-10)5-1-2-5/h3-5H,1-2,16H2 |
| InChIKey | PFVRLTHACRWUAS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|