C12H10F3NO2 — CID 114058156
3-methyl-4-(2,4,5-trifluorophenyl)piperidine-2,6-dione (PubChem CID 114058156) has the molecular formula C12H10F3NO2 and a molecular weight of 257.21 g/mol. Its IUPAC name is 3-methyl-4-(2,4,5-trifluorophenyl)piperidine-2,6-dione.
| Compound Name | 3-methyl-4-(2,4,5-trifluorophenyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 114058156 |
| Molecular Formula | C12H10F3NO2 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-methyl-4-(2,4,5-trifluorophenyl)piperidine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H10F3NO2/c1-5-6(3-11(17)16-12(5)18)7-2-9(14)10(15)4-8(7)13/h2,4-6H,3H2,1H3,(H,16,17,18) |
| InChIKey | BQHMOJZEUUQZBY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|