C12H12F2N2S — CID 114058402
1-[4-(2,3-difluorophenyl)-1,3-thiazol-2-yl]propan-1-amine (PubChem CID 114058402) has the molecular formula C12H12F2N2S and a molecular weight of 254.31 g/mol. Its IUPAC name is 1-[4-(2,3-difluorophenyl)-1,3-thiazol-2-yl]propan-1-amine.
| Compound Name | 1-[4-(2,3-difluorophenyl)-1,3-thiazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 114058402 |
| Molecular Formula | C12H12F2N2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-[4-(2,3-difluorophenyl)-1,3-thiazol-2-yl]propan-1-amine |
| SMILES | CCC(N)c1nc(-c2cccc(F)c2F)cs1 |
| InChI | InChI=1S/C12H12F2N2S/c1-2-9(15)12-16-10(6-17-12)7-4-3-5-8(13)11(7)14/h3-6,9H,2,15H2,1H3 |
| InChIKey | IBRKJHHZUWVGQD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |