About 3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole
3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole (PubChem CID 11405849) has the molecular formula C21H17FN2O3
and a molecular weight of 364.38 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole.
Molecular Properties
| Compound Name | 3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole |
| PubChem CID | 11405849 |
| Molecular Formula | C21H17FN2O3 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole |
| SMILES | COc1ccc(OC)c(-c2n[nH]c3cc(Oc4ccccc4F)ccc23)c1 |
| InChI | InChI=1S/C21H17FN2O3/c1-25-13-8-10-19(26-2)16(11-13)21-15-9-7-14(12-18(15)23-24-21)27-20-6-4-3-5-17(20)22/h3-12H,1-2H3,(H,23,24) |
| InChIKey | FXXLFQVIYUTTQG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole?
The IUPAC name of 3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole (CID 11405849) is 3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole.
What is the SMILES notation for 3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole?
The canonical SMILES for 3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole is COc1ccc(OC)c(-c2n[nH]c3cc(Oc4ccccc4F)ccc23)c1.
What is the InChIKey of 3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole?
The InChIKey is FXXLFQVIYUTTQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17FN2O3/c1-25-13-8-10-19(26-2)16(11-13)21-15-9-7-14(12-18(15)23-24-21)27-20-6-4-3-5-17(20)22/h3-12H,1-2H3,(H,23,24).
What are the key properties of 3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole?
3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole has a molecular weight of 364.38 g/mol, XLogP of 5.18, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethoxyphenyl)-6-(2-fluorophenoxy)-1H-indazole is sourced from PubChem (CID 11405849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).