C14H12Cl3NO4 — CID 11405874
2,5,6-trichloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]indole-3-carbaldehyde (PubChem CID 11405874) has the molecular formula C14H12Cl3NO4 and a molecular weight of 364.61 g/mol. Its IUPAC name is 2,5,6-trichloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]indole-3-carbaldehyde.
| Compound Name | 2,5,6-trichloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 11405874 |
| Molecular Formula | C14H12Cl3NO4 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | 2,5,6-trichloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]indole-3-carbaldehyde |
| SMILES | C[C@H]1O[C@@H](n2c(Cl)c(C=O)c3cc(Cl)c(Cl)cc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H12Cl3NO4/c1-5-11(20)12(21)14(22-5)18-10-3-9(16)8(15)2-6(10)7(4-19)13(18)17/h2-5,11-12,14,20-21H,1H3/t5-,11-,12-,14-/m1/s1 |
| InChIKey | JYOGKBXESSHWFA-YKURBOOJSA-N |
| XLogP | 3.05 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|