About 1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol
1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol (PubChem CID 114059264) has the molecular formula C12H16FNO3
and a molecular weight of 241.26 g/mol. Its IUPAC name is 1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | 1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol |
| PubChem CID | 114059264 |
| Molecular Formula | C12H16FNO3 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol |
| SMILES | CC(O)c1cccc(F)c1N1CC(O)C(O)C1 |
| InChI | InChI=1S/C12H16FNO3/c1-7(15)8-3-2-4-9(13)12(8)14-5-10(16)11(17)6-14/h2-4,7,10-11,15-17H,5-6H2,1H3 |
| InChIKey | JATACCOEOJFSTP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol?
The IUPAC name of 1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol (CID 114059264) is 1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol.
What is the SMILES notation for 1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol?
The canonical SMILES for 1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol is CC(O)c1cccc(F)c1N1CC(O)C(O)C1.
What is the InChIKey of 1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol?
The InChIKey is JATACCOEOJFSTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNO3/c1-7(15)8-3-2-4-9(13)12(8)14-5-10(16)11(17)6-14/h2-4,7,10-11,15-17H,5-6H2,1H3.
What are the key properties of 1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol?
1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol has a molecular weight of 241.26 g/mol, XLogP of 0.42, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-fluoro-6-(1-hydroxyethyl)phenyl]pyrrolidine-3,4-diol is sourced from PubChem (CID 114059264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).