3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid

C13H12F2N2O2 — CID 114059314

IUPAC3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid
SMILESCCCn1cc(C(=O)O)c(-c2cccc(F)c2F)n1
InChIInChI=1S/C13H12F2N2O2/c1-2-6-17-7-9(13(18)19)12(16-17)8-4-3-5-10(14)11(8)15/h3-5,7H,2,6H2,1H3,(H,18,19)
InChIKeySHRTZFLHIDPVQS-UHFFFAOYSA-N
MW266.25 g/mol
LogP2.94
Rot. Bonds4

About 3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid

3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid (PubChem CID 114059314) has the molecular formula C13H12F2N2O2 and a molecular weight of 266.25 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid.

Molecular Properties

Compound Name3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid
PubChem CID114059314
Molecular FormulaC13H12F2N2O2
Molecular Weight266.25 g/mol
Exact Mass266.09
IUPAC Name3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid
SMILESCCCn1cc(C(=O)O)c(-c2cccc(F)c2F)n1
InChIInChI=1S/C13H12F2N2O2/c1-2-6-17-7-9(13(18)19)12(16-17)8-4-3-5-10(14)11(8)15/h3-5,7H,2,6H2,1H3,(H,18,19)
InChIKeySHRTZFLHIDPVQS-UHFFFAOYSA-N
XLogP2.94
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.25
LogP ≤ 52.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid?
The IUPAC name of 3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid (CID 114059314) is 3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid.
What is the SMILES notation for 3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid?
The canonical SMILES for 3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid is CCCn1cc(C(=O)O)c(-c2cccc(F)c2F)n1.
What is the InChIKey of 3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid?
The InChIKey is SHRTZFLHIDPVQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N2O2/c1-2-6-17-7-9(13(18)19)12(16-17)8-4-3-5-10(14)11(8)15/h3-5,7H,2,6H2,1H3,(H,18,19).
What are the key properties of 3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid?
3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid has a molecular weight of 266.25 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-difluorophenyl)-1-propylpyrazole-4-carboxylic acid is sourced from PubChem (CID 114059314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).