About prop-2-enyl benzoate
prop-2-enyl benzoate (PubChem CID 11406) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is prop-2-enyl benzoate.
Molecular Properties
| Compound Name | prop-2-enyl benzoate |
| PubChem CID | 11406 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | prop-2-enyl benzoate |
| SMILES | C=CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H10O2/c1-2-8-12-10(11)9-6-4-3-5-7-9/h2-7H,1,8H2 |
| InChIKey | LYJHVEDILOKZCG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl benzoate?
The IUPAC name of prop-2-enyl benzoate (CID 11406) is prop-2-enyl benzoate.
What is the SMILES notation for prop-2-enyl benzoate?
The canonical SMILES for prop-2-enyl benzoate is C=CCOC(=O)c1ccccc1.
What is the InChIKey of prop-2-enyl benzoate?
The InChIKey is LYJHVEDILOKZCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-2-8-12-10(11)9-6-4-3-5-7-9/h2-7H,1,8H2.
What are the key properties of prop-2-enyl benzoate?
prop-2-enyl benzoate has a molecular weight of 162.19 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl benzoate is sourced from PubChem (CID 11406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).