About 3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate
3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate (PubChem CID 11406056) has the molecular formula C24H18O4
and a molecular weight of 370.40 g/mol. Its IUPAC name is 3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | 3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate |
| PubChem CID | 11406056 |
| Molecular Formula | C24H18O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate |
| SMILES | O=C(OCCCC1=CC(=O)c2ccccc2C1=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H18O4/c25-22-15-18(23(26)21-10-4-3-9-20(21)22)8-5-13-28-24(27)19-12-11-16-6-1-2-7-17(16)14-19/h1-4,6-7,9-12,14-15H,5,8,13H2 |
| InChIKey | LANUUQLIXPZWDX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate?
The IUPAC name of 3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate (CID 11406056) is 3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate.
What is the SMILES notation for 3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate?
The canonical SMILES for 3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate is O=C(OCCCC1=CC(=O)c2ccccc2C1=O)c1ccc2ccccc2c1.
What is the InChIKey of 3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate?
The InChIKey is LANUUQLIXPZWDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18O4/c25-22-15-18(23(26)21-10-4-3-9-20(21)22)8-5-13-28-24(27)19-12-11-16-6-1-2-7-17(16)14-19/h1-4,6-7,9-12,14-15H,5,8,13H2.
What are the key properties of 3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate?
3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate has a molecular weight of 370.40 g/mol, XLogP of 4.78, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-dioxonaphthalen-2-yl)propyl naphthalene-2-carboxylate is sourced from PubChem (CID 11406056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).