C14H24F3NO3SSi — CID 11406102
tert-butyl-dimethyl-[(1-methylpyridin-1-ium-4-yl)methyl]silane;trifluoromethanesulfonate (PubChem CID 11406102) has the molecular formula C14H24F3NO3SSi and a molecular weight of 371.50 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1-methylpyridin-1-ium-4-yl)methyl]silane;trifluoromethanesulfonate.
| Compound Name | tert-butyl-dimethyl-[(1-methylpyridin-1-ium-4-yl)methyl]silane;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11406102 |
| Molecular Formula | C14H24F3NO3SSi |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | tert-butyl-dimethyl-[(1-methylpyridin-1-ium-4-yl)methyl]silane;trifluoromethanesulfonate |
| SMILES | C[n+]1ccc(C[Si](C)(C)C(C)(C)C)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C13H24NSi.CHF3O3S/c1-13(2,3)15(5,6)11-12-7-9-14(4)10-8-12;2-1(3,4)8(5,6)7/h7-10H,11H2,1-6H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | WPRUJUOWCTYCFQ-UHFFFAOYSA-M |
| XLogP | 3.15 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|