About (2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine
(2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine (PubChem CID 11406104) has the molecular formula C25H25NS
and a molecular weight of 371.55 g/mol. Its IUPAC name is (2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | (2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 11406104 |
| Molecular Formula | C25H25NS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine |
| SMILES | C[C@H]1C=C(Sc2ccccc2)C[C@@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H25NS/c1-20-17-24(27-23-15-9-4-10-16-23)18-25(22-13-7-3-8-14-22)26(20)19-21-11-5-2-6-12-21/h2-17,20,25H,18-19H2,1H3/t20-,25-/m0/s1 |
| InChIKey | AFFXHCGTEKXEBW-CPJSRVTESA-N |
| XLogP | 6.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine?
The IUPAC name of (2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine (CID 11406104) is (2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for (2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for (2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine is C[C@H]1C=C(Sc2ccccc2)C[C@@H](c2ccccc2)N1Cc1ccccc1.
What is the InChIKey of (2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine?
The InChIKey is AFFXHCGTEKXEBW-CPJSRVTESA-N. The full InChI is InChI=1S/C25H25NS/c1-20-17-24(27-23-15-9-4-10-16-23)18-25(22-13-7-3-8-14-22)26(20)19-21-11-5-2-6-12-21/h2-17,20,25H,18-19H2,1H3/t20-,25-/m0/s1.
What are the key properties of (2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine?
(2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine has a molecular weight of 371.55 g/mol, XLogP of 6.70, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6S)-1-benzyl-6-methyl-2-phenyl-4-phenylsulfanyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 11406104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).