About 1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine
1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine (PubChem CID 114061775) has the molecular formula C12H17BrN2OS
and a molecular weight of 317.25 g/mol. Its IUPAC name is 1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine |
| PubChem CID | 114061775 |
| Molecular Formula | C12H17BrN2OS |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(Br)ccc1N1CCS(=O)CC1 |
| InChI | InChI=1S/C12H17BrN2OS/c1-14-9-10-8-11(13)2-3-12(10)15-4-6-17(16)7-5-15/h2-3,8,14H,4-7,9H2,1H3 |
| InChIKey | HKUFRQTVBCBEOA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine?
The IUPAC name of 1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine (CID 114061775) is 1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine.
What is the SMILES notation for 1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine?
The canonical SMILES for 1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine is CNCc1cc(Br)ccc1N1CCS(=O)CC1.
What is the InChIKey of 1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine?
The InChIKey is HKUFRQTVBCBEOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2OS/c1-14-9-10-8-11(13)2-3-12(10)15-4-6-17(16)7-5-15/h2-3,8,14H,4-7,9H2,1H3.
What are the key properties of 1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine?
1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine has a molecular weight of 317.25 g/mol, XLogP of 1.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-bromo-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanamine is sourced from PubChem (CID 114061775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).