C14H23BrN2 — CID 114062831
2-bromo-N-methyl-4-(methylaminomethyl)-N-(2-methylbutan-2-yl)aniline (PubChem CID 114062831) has the molecular formula C14H23BrN2 and a molecular weight of 299.26 g/mol. Its IUPAC name is 2-bromo-N-methyl-4-(methylaminomethyl)-N-(2-methylbutan-2-yl)aniline.
| Compound Name | 2-bromo-N-methyl-4-(methylaminomethyl)-N-(2-methylbutan-2-yl)aniline |
|---|---|
| PubChem CID | 114062831 |
| Molecular Formula | C14H23BrN2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-bromo-N-methyl-4-(methylaminomethyl)-N-(2-methylbutan-2-yl)aniline |
| SMILES | CCC(C)(C)N(C)c1ccc(CNC)cc1Br |
| InChI | InChI=1S/C14H23BrN2/c1-6-14(2,3)17(5)13-8-7-11(10-16-4)9-12(13)15/h7-9,16H,6,10H2,1-5H3 |
| InChIKey | PFXHNJHEWUSKDH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|