C14H8Cl3NO — CID 114063689
5-(chloromethyl)-2-(3,5-dichlorophenoxy)benzonitrile (PubChem CID 114063689) has the molecular formula C14H8Cl3NO and a molecular weight of 312.58 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(3,5-dichlorophenoxy)benzonitrile.
| Compound Name | 5-(chloromethyl)-2-(3,5-dichlorophenoxy)benzonitrile |
|---|---|
| PubChem CID | 114063689 |
| Molecular Formula | C14H8Cl3NO |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 5-(chloromethyl)-2-(3,5-dichlorophenoxy)benzonitrile |
| SMILES | N#Cc1cc(CCl)ccc1Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H8Cl3NO/c15-7-9-1-2-14(10(3-9)8-18)19-13-5-11(16)4-12(17)6-13/h1-6H,7H2 |
| InChIKey | FMBARNVCLQLMBZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|