C22H36O5 — CID 11406374
[(2S,3R,4S)-2-[(2S,3S)-6-ethyl-3,5-dimethyl-4-oxo-2,3-dihydropyran-2-yl]-4-methyl-5-oxoheptan-3-yl] (2S)-2-methylbutanoate (PubChem CID 11406374) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is [(2S,3R,4S)-2-[(2S,3S)-6-ethyl-3,5-dimethyl-4-oxo-2,3-dihydropyran-2-yl]-4-methyl-5-oxoheptan-3-yl] (2S)-2-methylbutanoate.
| Compound Name | [(2S,3R,4S)-2-[(2S,3S)-6-ethyl-3,5-dimethyl-4-oxo-2,3-dihydropyran-2-yl]-4-methyl-5-oxoheptan-3-yl] (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 11406374 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | [(2S,3R,4S)-2-[(2S,3S)-6-ethyl-3,5-dimethyl-4-oxo-2,3-dihydropyran-2-yl]-4-methyl-5-oxoheptan-3-yl] (2S)-2-methylbutanoate |
| SMILES | CCC(=O)[C@@H](C)[C@H](OC(=O)[C@@H](C)CC)[C@@H](C)[C@@H]1OC(CC)=C(C)C(=O)[C@H]1C |
| InChI | InChI=1S/C22H36O5/c1-9-12(4)22(25)27-20(13(5)17(23)10-2)16(8)21-15(7)19(24)14(6)18(11-3)26-21/h12-13,15-16,20-21H,9-11H2,1-8H3/t12-,13+,15+,16+,20-,21+/m0/s1 |
| InChIKey | DMAHVVWRJAEYPR-JTUGRMPVSA-N |
| XLogP | 4.48 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |