About 5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile
5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile (PubChem CID 114063792) has the molecular formula C14H19N3S
and a molecular weight of 261.39 g/mol. Its IUPAC name is 5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile.
Molecular Properties
| Compound Name | 5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile |
| PubChem CID | 114063792 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile |
| SMILES | CC1CN(c2ccc(CN)cc2C#N)CC(C)S1 |
| InChI | InChI=1S/C14H19N3S/c1-10-8-17(9-11(2)18-10)14-4-3-12(6-15)5-13(14)7-16/h3-5,10-11H,6,8-9,15H2,1-2H3 |
| InChIKey | VITFBRTYZHMQBE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile?
The IUPAC name of 5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile (CID 114063792) is 5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile.
What is the SMILES notation for 5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile?
The canonical SMILES for 5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile is CC1CN(c2ccc(CN)cc2C#N)CC(C)S1.
What is the InChIKey of 5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile?
The InChIKey is VITFBRTYZHMQBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3S/c1-10-8-17(9-11(2)18-10)14-4-3-12(6-15)5-13(14)7-16/h3-5,10-11H,6,8-9,15H2,1-2H3.
What are the key properties of 5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile?
5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile has a molecular weight of 261.39 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-2-(2,6-dimethylthiomorpholin-4-yl)benzonitrile is sourced from PubChem (CID 114063792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).