C14H20N2S — CID 114063907
2-ethylsulfanyl-5-[(2-methylpropylamino)methyl]benzonitrile (PubChem CID 114063907) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 2-ethylsulfanyl-5-[(2-methylpropylamino)methyl]benzonitrile.
| Compound Name | 2-ethylsulfanyl-5-[(2-methylpropylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 114063907 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-ethylsulfanyl-5-[(2-methylpropylamino)methyl]benzonitrile |
| SMILES | CCSc1ccc(CNCC(C)C)cc1C#N |
| InChI | InChI=1S/C14H20N2S/c1-4-17-14-6-5-12(7-13(14)8-15)10-16-9-11(2)3/h5-7,11,16H,4,9-10H2,1-3H3 |
| InChIKey | MZXYASPDRWCXPL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |