C20H18N2O6 — CID 11406425
methyl (4S,5S)-2-(4-methoxyphenyl)-5-[(E)-2-(4-nitrophenyl)ethenyl]-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 11406425) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is methyl (4S,5S)-2-(4-methoxyphenyl)-5-[(E)-2-(4-nitrophenyl)ethenyl]-4,5-dihydro-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4S,5S)-2-(4-methoxyphenyl)-5-[(E)-2-(4-nitrophenyl)ethenyl]-4,5-dihydro-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 11406425 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | methyl (4S,5S)-2-(4-methoxyphenyl)-5-[(E)-2-(4-nitrophenyl)ethenyl]-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)[C@H]1N=C(c2ccc(OC)cc2)O[C@H]1/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H18N2O6/c1-26-16-10-6-14(7-11-16)19-21-18(20(23)27-2)17(28-19)12-5-13-3-8-15(9-4-13)22(24)25/h3-12,17-18H,1-2H3/b12-5+/t17-,18-/m0/s1 |
| InChIKey | UZCGCWTZZYRMQY-JPBFSVSUSA-N |
| XLogP | 3.00 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|