C13H15FN2O2 — CID 114065362
[2-fluoro-6-(1,3,5-trimethylpyrazol-4-yl)oxyphenyl]methanol (PubChem CID 114065362) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is [2-fluoro-6-(1,3,5-trimethylpyrazol-4-yl)oxyphenyl]methanol.
| Compound Name | [2-fluoro-6-(1,3,5-trimethylpyrazol-4-yl)oxyphenyl]methanol |
|---|---|
| PubChem CID | 114065362 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | [2-fluoro-6-(1,3,5-trimethylpyrazol-4-yl)oxyphenyl]methanol |
| SMILES | Cc1nn(C)c(C)c1Oc1cccc(F)c1CO |
| InChI | InChI=1S/C13H15FN2O2/c1-8-13(9(2)16(3)15-8)18-12-6-4-5-11(14)10(12)7-17/h4-6,17H,7H2,1-3H3 |
| InChIKey | NHUWWTNSFWGJRN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |