About 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea
3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea (PubChem CID 11406685) has the molecular formula C15H22ClN3O3S2
and a molecular weight of 391.95 g/mol. Its IUPAC name is 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea.
Molecular Properties
| Compound Name | 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea |
| PubChem CID | 11406685 |
| Molecular Formula | C15H22ClN3O3S2 |
| Molecular Weight | 391.95 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea |
| SMILES | O=C(Nc1ncc(Cl)s1)N(C1CCCCC1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H22ClN3O3S2/c16-13-10-17-14(23-13)18-15(20)19(11-4-2-1-3-5-11)12-6-8-24(21,22)9-7-12/h10-12H,1-9H2,(H,17,18,20) |
| InChIKey | JWDRYYOJQGIXFM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.95 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea?
The IUPAC name of 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea (CID 11406685) is 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea.
What is the SMILES notation for 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea?
The canonical SMILES for 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea is O=C(Nc1ncc(Cl)s1)N(C1CCCCC1)C1CCS(=O)(=O)CC1.
What is the InChIKey of 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea?
The InChIKey is JWDRYYOJQGIXFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22ClN3O3S2/c16-13-10-17-14(23-13)18-15(20)19(11-4-2-1-3-5-11)12-6-8-24(21,22)9-7-12/h10-12H,1-9H2,(H,17,18,20).
What are the key properties of 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea?
3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea has a molecular weight of 391.95 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothian-4-yl)urea is sourced from PubChem (CID 11406685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).