C14H21NO2 — CID 114066920
1-[4-[2-hydroxyethyl(prop-2-enyl)amino]phenyl]propan-1-ol (PubChem CID 114066920) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-[4-[2-hydroxyethyl(prop-2-enyl)amino]phenyl]propan-1-ol.
| Compound Name | 1-[4-[2-hydroxyethyl(prop-2-enyl)amino]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 114066920 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-[4-[2-hydroxyethyl(prop-2-enyl)amino]phenyl]propan-1-ol |
| SMILES | C=CCN(CCO)c1ccc(C(O)CC)cc1 |
| InChI | InChI=1S/C14H21NO2/c1-3-9-15(10-11-16)13-7-5-12(6-8-13)14(17)4-2/h3,5-8,14,16-17H,1,4,9-11H2,2H3 |
| InChIKey | TVGCGBGQPOISQW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|