C16H20ClNO — CID 114067019
2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-chlorobenzaldehyde (PubChem CID 114067019) has the molecular formula C16H20ClNO and a molecular weight of 277.79 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-chlorobenzaldehyde.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-chlorobenzaldehyde |
|---|---|
| PubChem CID | 114067019 |
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.79 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-chlorobenzaldehyde |
| SMILES | O=Cc1cccc(Cl)c1N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C16H20ClNO/c17-15-7-3-6-14(11-19)16(15)18-9-8-12-4-1-2-5-13(12)10-18/h3,6-7,11-13H,1-2,4-5,8-10H2 |
| InChIKey | UXRRNXPRJZDBEN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.79 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|