C21H30O7 — CID 11406752
[(1R,2Z,4R,8R,9R,11R,12R)-1,12-dimethoxy-2,11-dimethyl-7-methylidene-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-9-yl] 2-methylpropanoate (PubChem CID 11406752) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is [(1R,2Z,4R,8R,9R,11R,12R)-1,12-dimethoxy-2,11-dimethyl-7-methylidene-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-9-yl] 2-methylpropanoate.
| Compound Name | [(1R,2Z,4R,8R,9R,11R,12R)-1,12-dimethoxy-2,11-dimethyl-7-methylidene-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-9-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 11406752 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [(1R,2Z,4R,8R,9R,11R,12R)-1,12-dimethoxy-2,11-dimethyl-7-methylidene-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradec-2-en-9-yl] 2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(/C)[C@@]3(OC)C[C@@H](OC)[C@@](C)(C[C@@H](OC(=O)C(C)C)[C@@H]12)O3 |
| InChI | InChI=1S/C21H30O7/c1-11(2)18(22)27-15-9-20(5)16(24-6)10-21(25-7,28-20)12(3)8-14-17(15)13(4)19(23)26-14/h8,11,14-17H,4,9-10H2,1-3,5-7H3/b12-8-/t14-,15-,16-,17+,20-,21-/m1/s1 |
| InChIKey | CKIYXPLLXPJWGV-JAKLVDHESA-N |
| XLogP | 2.54 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|