C27H38O2 — CID 11406765
(3R,8R,9S,10S,13S,14S)-3-benzyl-3-methoxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 11406765) has the molecular formula C27H38O2 and a molecular weight of 394.60 g/mol. Its IUPAC name is (3R,8R,9S,10S,13S,14S)-3-benzyl-3-methoxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,8R,9S,10S,13S,14S)-3-benzyl-3-methoxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 11406765 |
| Molecular Formula | C27H38O2 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | (3R,8R,9S,10S,13S,14S)-3-benzyl-3-methoxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CO[C@]1(Cc2ccccc2)CC[C@@]2(C)C(CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C27H38O2/c1-25-15-16-27(29-3,17-19-7-5-4-6-8-19)18-20(25)9-10-21-22-11-12-24(28)26(22,2)14-13-23(21)25/h4-8,20-23H,9-18H2,1-3H3/t20?,21-,22-,23-,25-,26-,27-/m0/s1 |
| InChIKey | ZGCFPQOIBUKGPL-LISMKILASA-N |
| XLogP | 6.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |