C11H11BrFN3S — CID 114069218
N-[[4-(2-bromo-4-fluorophenyl)thiadiazol-5-yl]methyl]ethanamine (PubChem CID 114069218) has the molecular formula C11H11BrFN3S and a molecular weight of 316.20 g/mol. Its IUPAC name is N-[[4-(2-bromo-4-fluorophenyl)thiadiazol-5-yl]methyl]ethanamine.
| Compound Name | N-[[4-(2-bromo-4-fluorophenyl)thiadiazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 114069218 |
| Molecular Formula | C11H11BrFN3S |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | N-[[4-(2-bromo-4-fluorophenyl)thiadiazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1snnc1-c1ccc(F)cc1Br |
| InChI | InChI=1S/C11H11BrFN3S/c1-2-14-6-10-11(15-16-17-10)8-4-3-7(13)5-9(8)12/h3-5,14H,2,6H2,1H3 |
| InChIKey | ZLDWSIQZDBPBEO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |