C12H16BrNO2S — CID 114069717
(1S)-1-[2-bromo-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanol (PubChem CID 114069717) has the molecular formula C12H16BrNO2S and a molecular weight of 318.24 g/mol. Its IUPAC name is (1S)-1-[2-bromo-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanol.
| Compound Name | (1S)-1-[2-bromo-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 114069717 |
| Molecular Formula | C12H16BrNO2S |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | (1S)-1-[2-bromo-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanol |
| SMILES | C[C@H](O)c1ccc(N2CCS(=O)CC2)cc1Br |
| InChI | InChI=1S/C12H16BrNO2S/c1-9(15)11-3-2-10(8-12(11)13)14-4-6-17(16)7-5-14/h2-3,8-9,15H,4-7H2,1H3/t9-/m0/s1 |
| InChIKey | KROPWNJXLKSWBA-VIFPVBQESA-N |
| XLogP | 2.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|