About mercury(2+) dibenzoate
mercury(2+) dibenzoate (PubChem CID 11407) has the molecular formula C14H10HgO4
and a molecular weight of 442.82 g/mol. Its IUPAC name is mercury(2+) dibenzoate.
Molecular Properties
| Compound Name | mercury(2+) dibenzoate |
| PubChem CID | 11407 |
| Molecular Formula | C14H10HgO4 |
| Molecular Weight | 442.82 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | mercury(2+) dibenzoate |
| SMILES | O=C([O-])c1ccccc1.O=C([O-])c1ccccc1.[Hg+2] |
| InChI | InChI=1S/2C7H6O2.Hg/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);/q;;+2/p-2 |
| InChIKey | FJKFBLLIOVQLFS-UHFFFAOYSA-L |
| XLogP | 0.10 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.82 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze mercury(2+) dibenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of mercury(2+) dibenzoate?
The IUPAC name of mercury(2+) dibenzoate (CID 11407) is mercury(2+) dibenzoate.
What is the SMILES notation for mercury(2+) dibenzoate?
The canonical SMILES for mercury(2+) dibenzoate is O=C([O-])c1ccccc1.O=C([O-])c1ccccc1.[Hg+2].
What is the InChIKey of mercury(2+) dibenzoate?
The InChIKey is FJKFBLLIOVQLFS-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H6O2.Hg/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);/q;;+2/p-2.
What are the key properties of mercury(2+) dibenzoate?
mercury(2+) dibenzoate has a molecular weight of 442.82 g/mol, XLogP of 0.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for mercury(2+) dibenzoate is sourced from PubChem (CID 11407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).