C12H20N4O2 — CID 114071050
2-N-ethyl-6-N-(3-methylbutyl)-4-nitropyridine-2,6-diamine (PubChem CID 114071050) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-N-ethyl-6-N-(3-methylbutyl)-4-nitropyridine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-(3-methylbutyl)-4-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 114071050 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2-N-ethyl-6-N-(3-methylbutyl)-4-nitropyridine-2,6-diamine |
| SMILES | CCNc1cc([N+](=O)[O-])cc(NCCC(C)C)n1 |
| InChI | InChI=1S/C12H20N4O2/c1-4-13-11-7-10(16(17)18)8-12(15-11)14-6-5-9(2)3/h7-9H,4-6H2,1-3H3,(H2,13,14,15) |
| InChIKey | GBKRWVBPOGKTPP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|