About N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine
N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine (PubChem CID 114071375) has the molecular formula C8H7N5O2S2
and a molecular weight of 269.31 g/mol. Its IUPAC name is N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine.
Molecular Properties
| Compound Name | N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine |
| PubChem CID | 114071375 |
| Molecular Formula | C8H7N5O2S2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine |
| SMILES | CNc1cc([N+](=O)[O-])cc(Sc2nncs2)n1 |
| InChI | InChI=1S/C8H7N5O2S2/c1-9-6-2-5(13(14)15)3-7(11-6)17-8-12-10-4-16-8/h2-4H,1H3,(H,9,11) |
| InChIKey | VFBQZFKBOKBUJD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine?
The IUPAC name of N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine (CID 114071375) is N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine.
What is the SMILES notation for N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine?
The canonical SMILES for N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine is CNc1cc([N+](=O)[O-])cc(Sc2nncs2)n1.
What is the InChIKey of N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine?
The InChIKey is VFBQZFKBOKBUJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O2S2/c1-9-6-2-5(13(14)15)3-7(11-6)17-8-12-10-4-16-8/h2-4H,1H3,(H,9,11).
What are the key properties of N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine?
N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine has a molecular weight of 269.31 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-nitro-6-(1,3,4-thiadiazol-2-ylsulfanyl)pyridin-2-amine is sourced from PubChem (CID 114071375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).