C11H18N6O3 — CID 114071562
3-[(6-hydrazinyl-4-nitro-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide (PubChem CID 114071562) has the molecular formula C11H18N6O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-[(6-hydrazinyl-4-nitro-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide.
| Compound Name | 3-[(6-hydrazinyl-4-nitro-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 114071562 |
| Molecular Formula | C11H18N6O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-[(6-hydrazinyl-4-nitro-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide |
| SMILES | CNC(=O)C(C)CN(C)c1cc([N+](=O)[O-])cc(NN)n1 |
| InChI | InChI=1S/C11H18N6O3/c1-7(11(18)13-2)6-16(3)10-5-8(17(19)20)4-9(14-10)15-12/h4-5,7H,6,12H2,1-3H3,(H,13,18)(H,14,15) |
| InChIKey | SWJNCLZSEZVRIY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 126.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|