C11H18N4O4 — CID 114071599
[6-[2-(2-methylpropoxy)ethoxy]-4-nitro-2-pyridinyl]hydrazine (PubChem CID 114071599) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is [6-[2-(2-methylpropoxy)ethoxy]-4-nitro-2-pyridinyl]hydrazine.
| Compound Name | [6-[2-(2-methylpropoxy)ethoxy]-4-nitro-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 114071599 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [6-[2-(2-methylpropoxy)ethoxy]-4-nitro-2-pyridinyl]hydrazine |
| SMILES | CC(C)COCCOc1cc([N+](=O)[O-])cc(NN)n1 |
| InChI | InChI=1S/C11H18N4O4/c1-8(2)7-18-3-4-19-11-6-9(15(16)17)5-10(13-11)14-12/h5-6,8H,3-4,7,12H2,1-2H3,(H,13,14) |
| InChIKey | ISBPLBJJFYGATP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|