About 5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine
5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine (PubChem CID 114071900) has the molecular formula C12H20BrN5
and a molecular weight of 314.23 g/mol. Its IUPAC name is 5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine |
| PubChem CID | 114071900 |
| Molecular Formula | C12H20BrN5 |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine |
| SMILES | CNc1ncnc(N(C)C2CCN(C)CC2)c1Br |
| InChI | InChI=1S/C12H20BrN5/c1-14-11-10(13)12(16-8-15-11)18(3)9-4-6-17(2)7-5-9/h8-9H,4-7H2,1-3H3,(H,14,15,16) |
| InChIKey | RXZNXBYLTRGLBM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine?
The IUPAC name of 5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine (CID 114071900) is 5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine.
What is the SMILES notation for 5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine?
The canonical SMILES for 5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine is CNc1ncnc(N(C)C2CCN(C)CC2)c1Br.
What is the InChIKey of 5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine?
The InChIKey is RXZNXBYLTRGLBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20BrN5/c1-14-11-10(13)12(16-8-15-11)18(3)9-4-6-17(2)7-5-9/h8-9H,4-7H2,1-3H3,(H,14,15,16).
What are the key properties of 5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine?
5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine has a molecular weight of 314.23 g/mol, XLogP of 1.81, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-N,6-N-dimethyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine is sourced from PubChem (CID 114071900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).