C11H5BrClF3N2 — CID 114072741
N-(4-bromo-3-chlorophenyl)-3,5,6-trifluoropyridin-2-amine (PubChem CID 114072741) has the molecular formula C11H5BrClF3N2 and a molecular weight of 337.53 g/mol. Its IUPAC name is N-(4-bromo-3-chlorophenyl)-3,5,6-trifluoropyridin-2-amine.
| Compound Name | N-(4-bromo-3-chlorophenyl)-3,5,6-trifluoropyridin-2-amine |
|---|---|
| PubChem CID | 114072741 |
| Molecular Formula | C11H5BrClF3N2 |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 335.93 |
| IUPAC Name | N-(4-bromo-3-chlorophenyl)-3,5,6-trifluoropyridin-2-amine |
| SMILES | Fc1cc(F)c(Nc2ccc(Br)c(Cl)c2)nc1F |
| InChI | InChI=1S/C11H5BrClF3N2/c12-6-2-1-5(3-7(6)13)17-11-9(15)4-8(14)10(16)18-11/h1-4H,(H,17,18) |
| InChIKey | UPAODVVYIBAZTD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|