C23H48O2Si2 — CID 11407294
tert-butyl-[(2R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloct-7-ynoxy]-dimethylsilane (PubChem CID 11407294) has the molecular formula C23H48O2Si2 and a molecular weight of 412.81 g/mol. Its IUPAC name is tert-butyl-[(2R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloct-7-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloct-7-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11407294 |
| Molecular Formula | C23H48O2Si2 |
| Molecular Weight | 412.81 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | tert-butyl-[(2R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloct-7-ynoxy]-dimethylsilane |
| SMILES | C#C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O2Si2/c1-15-19(3)21(25-27(13,14)23(8,9)10)20(4)16-18(2)17-24-26(11,12)22(5,6)7/h1,18-21H,16-17H2,2-14H3/t18-,19+,20+,21+/m1/s1 |
| InChIKey | AYPPPHYHITUTBD-ANULTFPQSA-N |
| XLogP | 7.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.81 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|