C20H14ClF2N5O — CID 11407313
1-[4-(3-amino-1H-indazol-4-yl)-2-fluorophenyl]-3-(3-chloro-4-fluorophenyl)urea (PubChem CID 11407313) has the molecular formula C20H14ClF2N5O and a molecular weight of 413.82 g/mol. Its IUPAC name is 1-[4-(3-amino-1H-indazol-4-yl)-2-fluorophenyl]-3-(3-chloro-4-fluorophenyl)urea.
| Compound Name | 1-[4-(3-amino-1H-indazol-4-yl)-2-fluorophenyl]-3-(3-chloro-4-fluorophenyl)urea |
|---|---|
| PubChem CID | 11407313 |
| Molecular Formula | C20H14ClF2N5O |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 1-[4-(3-amino-1H-indazol-4-yl)-2-fluorophenyl]-3-(3-chloro-4-fluorophenyl)urea |
| SMILES | Nc1n[nH]c2cccc(-c3ccc(NC(=O)Nc4ccc(F)c(Cl)c4)c(F)c3)c12 |
| InChI | InChI=1S/C20H14ClF2N5O/c21-13-9-11(5-6-14(13)22)25-20(29)26-16-7-4-10(8-15(16)23)12-2-1-3-17-18(12)19(24)28-27-17/h1-9H,(H3,24,27,28)(H2,25,26,29) |
| InChIKey | XTGFKWJKRWPKSI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |