About N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine
N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine (PubChem CID 114073139) has the molecular formula C13H13F3N4
and a molecular weight of 282.27 g/mol. Its IUPAC name is N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine.
Molecular Properties
| Compound Name | N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine |
| PubChem CID | 114073139 |
| Molecular Formula | C13H13F3N4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine |
| SMILES | CCN(c1ccc(F)cc1)c1nc(NN)c(F)cc1F |
| InChI | InChI=1S/C13H13F3N4/c1-2-20(9-5-3-8(14)4-6-9)13-11(16)7-10(15)12(18-13)19-17/h3-7H,2,17H2,1H3,(H,18,19) |
| InChIKey | ABUZCOPVEDYLEY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine?
The IUPAC name of N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine (CID 114073139) is N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine.
What is the SMILES notation for N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine?
The canonical SMILES for N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine is CCN(c1ccc(F)cc1)c1nc(NN)c(F)cc1F.
What is the InChIKey of N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine?
The InChIKey is ABUZCOPVEDYLEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N4/c1-2-20(9-5-3-8(14)4-6-9)13-11(16)7-10(15)12(18-13)19-17/h3-7H,2,17H2,1H3,(H,18,19).
What are the key properties of N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine?
N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine has a molecular weight of 282.27 g/mol, XLogP of 2.94, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,5-difluoro-N-(4-fluorophenyl)-6-hydrazinylpyridin-2-amine is sourced from PubChem (CID 114073139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).