About 6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine
6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine (PubChem CID 11407335) has the molecular formula C13H12ClIN6
and a molecular weight of 414.64 g/mol. Its IUPAC name is 6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine.
Molecular Properties
| Compound Name | 6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine |
| PubChem CID | 11407335 |
| Molecular Formula | C13H12ClIN6 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine |
| SMILES | Cc1cnc(Cn2cnc3c(Cl)nc(N)nc32)c(C)c1I |
| InChI | InChI=1S/C13H12ClIN6/c1-6-3-17-8(7(2)9(6)15)4-21-5-18-10-11(14)19-13(16)20-12(10)21/h3,5H,4H2,1-2H3,(H2,16,19,20) |
| InChIKey | CQDQVQZAUBBHPH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine?
The IUPAC name of 6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine (CID 11407335) is 6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine.
What is the SMILES notation for 6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine?
The canonical SMILES for 6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine is Cc1cnc(Cn2cnc3c(Cl)nc(N)nc32)c(C)c1I.
What is the InChIKey of 6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine?
The InChIKey is CQDQVQZAUBBHPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClIN6/c1-6-3-17-8(7(2)9(6)15)4-21-5-18-10-11(14)19-13(16)20-12(10)21/h3,5H,4H2,1-2H3,(H2,16,19,20).
What are the key properties of 6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine?
6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine has a molecular weight of 414.64 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-9-[(4-iodo-3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine is sourced from PubChem (CID 11407335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).