C11H7F3N2S — CID 114073919
3,5-difluoro-6-(3-fluorophenyl)sulfanylpyridin-2-amine (PubChem CID 114073919) has the molecular formula C11H7F3N2S and a molecular weight of 256.25 g/mol. Its IUPAC name is 3,5-difluoro-6-(3-fluorophenyl)sulfanylpyridin-2-amine.
| Compound Name | 3,5-difluoro-6-(3-fluorophenyl)sulfanylpyridin-2-amine |
|---|---|
| PubChem CID | 114073919 |
| Molecular Formula | C11H7F3N2S |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 3,5-difluoro-6-(3-fluorophenyl)sulfanylpyridin-2-amine |
| SMILES | Nc1nc(Sc2cccc(F)c2)c(F)cc1F |
| InChI | InChI=1S/C11H7F3N2S/c12-6-2-1-3-7(4-6)17-11-9(14)5-8(13)10(15)16-11/h1-5H,(H2,15,16) |
| InChIKey | PNHJKGQJQRCIJD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |