About 5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid
5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid (PubChem CID 114074005) has the molecular formula C10H11Br2N3O3
and a molecular weight of 381.02 g/mol. Its IUPAC name is 5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid.
Molecular Properties
| Compound Name | 5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid |
| PubChem CID | 114074005 |
| Molecular Formula | C10H11Br2N3O3 |
| Molecular Weight | 381.02 g/mol |
| Exact Mass | 378.92 |
| IUPAC Name | 5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)Nc1ncc(Br)nc1Br |
| InChI | InChI=1S/C10H11Br2N3O3/c1-5(3-8(17)18)2-7(16)15-10-9(12)14-6(11)4-13-10/h4-5H,2-3H2,1H3,(H,17,18)(H,13,15,16) |
| InChIKey | OYJRKZLDEDMSCI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.02 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid?
The IUPAC name of 5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid (CID 114074005) is 5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid.
What is the SMILES notation for 5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid?
The canonical SMILES for 5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid is CC(CC(=O)O)CC(=O)Nc1ncc(Br)nc1Br.
What is the InChIKey of 5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid?
The InChIKey is OYJRKZLDEDMSCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Br2N3O3/c1-5(3-8(17)18)2-7(16)15-10-9(12)14-6(11)4-13-10/h4-5H,2-3H2,1H3,(H,17,18)(H,13,15,16).
What are the key properties of 5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid?
5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid has a molecular weight of 381.02 g/mol, XLogP of 2.44, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dibromopyrazin-2-yl)amino]-3-methyl-5-oxopentanoic acid is sourced from PubChem (CID 114074005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).