C22H44O5Si — CID 11407402
(2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4-methyl-1-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]pentan-2-ol (PubChem CID 11407402) has the molecular formula C22H44O5Si and a molecular weight of 416.68 g/mol. Its IUPAC name is (2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4-methyl-1-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]pentan-2-ol.
| Compound Name | (2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4-methyl-1-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]pentan-2-ol |
|---|---|
| PubChem CID | 11407402 |
| Molecular Formula | C22H44O5Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | (2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4-methyl-1-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]pentan-2-ol |
| SMILES | C=CC[C@@H]1O[C@@H](C[C@@H](O)[C@@H](OCOC)[C@H](C)CO[Si](C)(C)C(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C22H44O5Si/c1-10-11-20-16(2)12-18(27-20)13-19(23)21(25-15-24-7)17(3)14-26-28(8,9)22(4,5)6/h10,16-21,23H,1,11-15H2,2-9H3/t16-,17+,18+,19+,20-,21-/m0/s1 |
| InChIKey | FSRGCEUUWBFSFG-LPYKTLRWSA-N |
| XLogP | 4.75 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|