About 6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide
6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide (PubChem CID 114074106) has the molecular formula C9H5Br2ClN4O2S
and a molecular weight of 428.49 g/mol. Its IUPAC name is 6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide |
| PubChem CID | 114074106 |
| Molecular Formula | C9H5Br2ClN4O2S |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 425.82 |
| IUPAC Name | 6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ncc(Br)nc1Br)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H5Br2ClN4O2S/c10-6-4-14-9(8(11)15-6)16-19(17,18)5-1-2-7(12)13-3-5/h1-4H,(H,14,16) |
| InChIKey | NYCMWJUGPIMXSX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide?
The IUPAC name of 6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide (CID 114074106) is 6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide.
What is the SMILES notation for 6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide?
The canonical SMILES for 6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide is O=S(=O)(Nc1ncc(Br)nc1Br)c1ccc(Cl)nc1.
What is the InChIKey of 6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide?
The InChIKey is NYCMWJUGPIMXSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Br2ClN4O2S/c10-6-4-14-9(8(11)15-6)16-19(17,18)5-1-2-7(12)13-3-5/h1-4H,(H,14,16).
What are the key properties of 6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide?
6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide has a molecular weight of 428.49 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(3,5-dibromopyrazin-2-yl)pyridine-3-sulfonamide is sourced from PubChem (CID 114074106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).