About 2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol
2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol (PubChem CID 114074838) has the molecular formula C11H17F2N3O
and a molecular weight of 245.27 g/mol. Its IUPAC name is 2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | 2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol |
| PubChem CID | 114074838 |
| Molecular Formula | C11H17F2N3O |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol |
| SMILES | CNc1nc(NC(CO)C(C)C)c(F)cc1F |
| InChI | InChI=1S/C11H17F2N3O/c1-6(2)9(5-17)15-11-8(13)4-7(12)10(14-3)16-11/h4,6,9,17H,5H2,1-3H3,(H2,14,15,16) |
| InChIKey | HDYJPYKMWKFBRO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol?
The IUPAC name of 2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol (CID 114074838) is 2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol.
What is the SMILES notation for 2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol?
The canonical SMILES for 2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol is CNc1nc(NC(CO)C(C)C)c(F)cc1F.
What is the InChIKey of 2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol?
The InChIKey is HDYJPYKMWKFBRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N3O/c1-6(2)9(5-17)15-11-8(13)4-7(12)10(14-3)16-11/h4,6,9,17H,5H2,1-3H3,(H2,14,15,16).
What are the key properties of 2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol?
2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol has a molecular weight of 245.27 g/mol, XLogP of 1.83, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-difluoro-6-(methylamino)-2-pyridinyl]amino]-3-methylbutan-1-ol is sourced from PubChem (CID 114074838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).